C19H29NO3 — CID 174614352
3-amino-3-(4-methylcyclohexyl)-6-phenylhex-5-ene-1,4,4-triol (PubChem CID 174614352) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 3-amino-3-(4-methylcyclohexyl)-6-phenylhex-5-ene-1,4,4-triol.
| Compound Name | 3-amino-3-(4-methylcyclohexyl)-6-phenylhex-5-ene-1,4,4-triol |
|---|---|
| PubChem CID | 174614352 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3-amino-3-(4-methylcyclohexyl)-6-phenylhex-5-ene-1,4,4-triol |
| SMILES | CC1CCC(C(N)(CCO)C(O)(O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29NO3/c1-15-7-9-17(10-8-15)18(20,13-14-21)19(22,23)12-11-16-5-3-2-4-6-16/h2-6,11-12,15,17,21-23H,7-10,13-14,20H2,1H3 |
| InChIKey | SIVPVRWSWPJWEA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|