C15H15F3N2O2 — CID 174615107
[2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] formate (PubChem CID 174615107) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is [2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] formate.
| Compound Name | [2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] formate |
|---|---|
| PubChem CID | 174615107 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [2-(3,5-dimethyl-1H-pyrazol-4-yl)-1-[3-(trifluoromethyl)phenyl]ethyl] formate |
| SMILES | Cc1n[nH]c(C)c1CC(OC=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15F3N2O2/c1-9-13(10(2)20-19-9)7-14(22-8-21)11-4-3-5-12(6-11)15(16,17)18/h3-6,8,14H,7H2,1-2H3,(H,19,20) |
| InChIKey | JVSGUJSHLLPUII-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|