C14H15ClN2O2 — CID 174447240
[1-(3-chlorophenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl] formate (PubChem CID 174447240) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl] formate.
| Compound Name | [1-(3-chlorophenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl] formate |
|---|---|
| PubChem CID | 174447240 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | [1-(3-chlorophenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl] formate |
| SMILES | Cc1n[nH]c(C)c1CC(OC=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-9-13(10(2)17-16-9)7-14(19-8-18)11-4-3-5-12(15)6-11/h3-6,8,14H,7H2,1-2H3,(H,16,17) |
| InChIKey | HDAKFHHCCBFHBZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|