C19H13ClF4N2O2 — CID 174610664
[1-(3-chlorophenyl)-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]ethyl] formate (PubChem CID 174610664) has the molecular formula C19H13ClF4N2O2 and a molecular weight of 412.77 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]ethyl] formate.
| Compound Name | [1-(3-chlorophenyl)-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]ethyl] formate |
|---|---|
| PubChem CID | 174610664 |
| Molecular Formula | C19H13ClF4N2O2 |
| Molecular Weight | 412.77 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [1-(3-chlorophenyl)-2-[3-[3-fluoro-5-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]ethyl] formate |
| SMILES | O=COC(Cc1cc(-c2cc(F)cc(C(F)(F)F)c2)n[nH]1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H13ClF4N2O2/c20-14-3-1-2-11(5-14)18(28-10-27)9-16-8-17(26-25-16)12-4-13(19(22,23)24)7-15(21)6-12/h1-8,10,18H,9H2,(H,25,26) |
| InChIKey | VKMUHPIGPACSAO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|