C19H16F3N3O3 — CID 174599570
[2-(5-methyl-3-pyridin-4-yl-1H-pyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethyl] formate (PubChem CID 174599570) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is [2-(5-methyl-3-pyridin-4-yl-1H-pyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethyl] formate.
| Compound Name | [2-(5-methyl-3-pyridin-4-yl-1H-pyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethyl] formate |
|---|---|
| PubChem CID | 174599570 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [2-(5-methyl-3-pyridin-4-yl-1H-pyrazol-4-yl)-1-[3-(trifluoromethoxy)phenyl]ethyl] formate |
| SMILES | Cc1[nH]nc(-c2ccncc2)c1CC(OC=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N3O3/c1-12-16(18(25-24-12)13-5-7-23-8-6-13)10-17(27-11-26)14-3-2-4-15(9-14)28-19(20,21)22/h2-9,11,17H,10H2,1H3,(H,24,25) |
| InChIKey | QVBPRUFUHVCSPR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|