C14H15F3INO2 — CID 174617613
tert-butyl 3-iodo-5-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylate (PubChem CID 174617613) has the molecular formula C14H15F3INO2 and a molecular weight of 413.18 g/mol. Its IUPAC name is tert-butyl 3-iodo-5-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylate.
| Compound Name | tert-butyl 3-iodo-5-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 174617613 |
| Molecular Formula | C14H15F3INO2 |
| Molecular Weight | 413.18 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | tert-butyl 3-iodo-5-(trifluoromethyl)-2,3-dihydro-1H-indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1Nc2ccc(C(F)(F)F)cc2C1I |
| InChI | InChI=1S/C14H15F3INO2/c1-13(2,3)21-12(20)11-10(18)8-6-7(14(15,16)17)4-5-9(8)19-11/h4-6,10-11,19H,1-3H3 |
| InChIKey | HUVMMPSLDMXKKU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|