C19H24ClN3O3 — CID 17461832
N-(2-chlorophenyl)-2-[(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-methylamino]acetamide (PubChem CID 17461832) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-methylamino]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 17461832 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)CN1C(=O)CC2(CCCCC2)C1=O |
| InChI | InChI=1S/C19H24ClN3O3/c1-22(12-16(24)21-15-8-4-3-7-14(15)20)13-23-17(25)11-19(18(23)26)9-5-2-6-10-19/h3-4,7-8H,2,5-6,9-13H2,1H3,(H,21,24) |
| InChIKey | VHAWOOYYRAZTMV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|