C16H27N3O2 — CID 174619507
acetic acid;1-cyclopropyl-3,5-diethylbenzene;guanidine (PubChem CID 174619507) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is acetic acid;1-cyclopropyl-3,5-diethylbenzene;guanidine.
| Compound Name | acetic acid;1-cyclopropyl-3,5-diethylbenzene;guanidine |
|---|---|
| PubChem CID | 174619507 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | acetic acid;1-cyclopropyl-3,5-diethylbenzene;guanidine |
| SMILES | CC(=O)O.CCc1cc(CC)cc(C2CC2)c1.[H]N=C(N)N |
| InChI | InChI=1S/C13H18.C2H4O2.CH5N3/c1-3-10-7-11(4-2)9-13(8-10)12-5-6-12;1-2(3)4;2-1(3)4/h7-9,12H,3-6H2,1-2H3;1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | LUDBFPNLSVUXJW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|