C16H12N4O6S2 — CID 174619965
3-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-2-nitrobenzene-1,3-dicarboxamide (PubChem CID 174619965) has the molecular formula C16H12N4O6S2 and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-2-nitrobenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-2-nitrobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 174619965 |
| Molecular Formula | C16H12N4O6S2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 3-N-(6-methylsulfonyl-1,3-benzothiazol-2-yl)-2-nitrobenzene-1,3-dicarboxamide |
| SMILES | CS(=O)(=O)c1ccc2nc(NC(=O)c3cccc(C(N)=O)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C16H12N4O6S2/c1-28(25,26)8-5-6-11-12(7-8)27-16(18-11)19-15(22)10-4-2-3-9(14(17)21)13(10)20(23)24/h2-7H,1H3,(H2,17,21)(H,18,19,22) |
| InChIKey | JNRZBPUYGLPYED-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|