1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid

C17H19Cl2NO3 — CID 174624868

IUPAC1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid
SMILESC=Cc1ccncc1.CCOCC(=O)O.Clc1cccc(Cl)c1
InChIInChI=1S/C7H7N.C6H4Cl2.C4H8O3/c1-2-7-3-5-8-6-4-7;7-5-2-1-3-6(8)4-5;1-2-7-3-4(5)6/h2-6H,1H2;1-4H;2-3H2,1H3,(H,5,6)
InChIKeyUARWOHABMCPWRK-UHFFFAOYSA-N
MW356.25 g/mol
LogP4.83
Rot. Bonds4

About 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid

1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid (PubChem CID 174624868) has the molecular formula C17H19Cl2NO3 and a molecular weight of 356.25 g/mol. Its IUPAC name is 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid.

Molecular Properties

Compound Name1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid
PubChem CID174624868
Molecular FormulaC17H19Cl2NO3
Molecular Weight356.25 g/mol
Exact Mass355.07
IUPAC Name1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid
SMILESC=Cc1ccncc1.CCOCC(=O)O.Clc1cccc(Cl)c1
InChIInChI=1S/C7H7N.C6H4Cl2.C4H8O3/c1-2-7-3-5-8-6-4-7;7-5-2-1-3-6(8)4-5;1-2-7-3-4(5)6/h2-6H,1H2;1-4H;2-3H2,1H3,(H,5,6)
InChIKeyUARWOHABMCPWRK-UHFFFAOYSA-N
XLogP4.83
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.25
LogP ≤ 54.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid?
The IUPAC name of 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid (CID 174624868) is 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid.
What is the SMILES notation for 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid?
The canonical SMILES for 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid is C=Cc1ccncc1.CCOCC(=O)O.Clc1cccc(Cl)c1.
What is the InChIKey of 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid?
The InChIKey is UARWOHABMCPWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.C6H4Cl2.C4H8O3/c1-2-7-3-5-8-6-4-7;7-5-2-1-3-6(8)4-5;1-2-7-3-4(5)6/h2-6H,1H2;1-4H;2-3H2,1H3,(H,5,6).
What are the key properties of 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid?
1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid has a molecular weight of 356.25 g/mol, XLogP of 4.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichlorobenzene;4-ethenylpyridine;2-ethoxyacetic acid is sourced from PubChem (CID 174624868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).