C26H17NO4S — CID 174632078
(4-hydroxy-6-oxo-5-phenyl-7H-thieno[2,3-b]pyridin-3-yl) 4-phenylbenzoate (PubChem CID 174632078) has the molecular formula C26H17NO4S and a molecular weight of 439.49 g/mol. Its IUPAC name is (4-hydroxy-6-oxo-5-phenyl-7H-thieno[2,3-b]pyridin-3-yl) 4-phenylbenzoate.
| Compound Name | (4-hydroxy-6-oxo-5-phenyl-7H-thieno[2,3-b]pyridin-3-yl) 4-phenylbenzoate |
|---|---|
| PubChem CID | 174632078 |
| Molecular Formula | C26H17NO4S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (4-hydroxy-6-oxo-5-phenyl-7H-thieno[2,3-b]pyridin-3-yl) 4-phenylbenzoate |
| SMILES | O=C(Oc1csc2[nH]c(=O)c(-c3ccccc3)c(O)c12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H17NO4S/c28-23-21(18-9-5-2-6-10-18)24(29)27-25-22(23)20(15-32-25)31-26(30)19-13-11-17(12-14-19)16-7-3-1-4-8-16/h1-15H,(H2,27,28,29) |
| InChIKey | JZHLRJLCUAYBCP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |