C18H12N2O2S — CID 66936566
4-hydroxy-5-phenyl-3-pyridin-4-yl-7H-thieno[2,3-b]pyridin-6-one (PubChem CID 66936566) has the molecular formula C18H12N2O2S and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-hydroxy-5-phenyl-3-pyridin-4-yl-7H-thieno[2,3-b]pyridin-6-one.
| Compound Name | 4-hydroxy-5-phenyl-3-pyridin-4-yl-7H-thieno[2,3-b]pyridin-6-one |
|---|---|
| PubChem CID | 66936566 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 4-hydroxy-5-phenyl-3-pyridin-4-yl-7H-thieno[2,3-b]pyridin-6-one |
| SMILES | O=c1[nH]c2scc(-c3ccncc3)c2c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C18H12N2O2S/c21-16-14(12-4-2-1-3-5-12)17(22)20-18-15(16)13(10-23-18)11-6-8-19-9-7-11/h1-10H,(H2,20,21,22) |
| InChIKey | GKUGFALTXGJIHO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |