C24H30FN3O2 — CID 174634033
2-[benzyl-[2-(5-fluoro-1H-indol-3-yl)ethyl]amino]ethyl N-tert-butylcarbamate (PubChem CID 174634033) has the molecular formula C24H30FN3O2 and a molecular weight of 411.52 g/mol. Its IUPAC name is 2-[benzyl-[2-(5-fluoro-1H-indol-3-yl)ethyl]amino]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[benzyl-[2-(5-fluoro-1H-indol-3-yl)ethyl]amino]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174634033 |
| Molecular Formula | C24H30FN3O2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2-[benzyl-[2-(5-fluoro-1H-indol-3-yl)ethyl]amino]ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCN(CCc1c[nH]c2ccc(F)cc12)Cc1ccccc1 |
| InChI | InChI=1S/C24H30FN3O2/c1-24(2,3)27-23(29)30-14-13-28(17-18-7-5-4-6-8-18)12-11-19-16-26-22-10-9-20(25)15-21(19)22/h4-10,15-16,26H,11-14,17H2,1-3H3,(H,27,29) |
| InChIKey | OUDARIDZVGFTLF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |