About propan-2-ylsulfanyl-λ2-stannane
propan-2-ylsulfanyl-λ2-stannane (PubChem CID 174641413) has the molecular formula C3H8SSn
and a molecular weight of 194.88 g/mol. Its IUPAC name is propan-2-ylsulfanyl-λ2-stannane.
Molecular Properties
| Compound Name | propan-2-ylsulfanyl-λ2-stannane |
| PubChem CID | 174641413 |
| Molecular Formula | C3H8SSn |
| Molecular Weight | 194.88 g/mol |
| Exact Mass | 195.94 |
| IUPAC Name | propan-2-ylsulfanyl-λ2-stannane |
| SMILES | CC(C)S[SnH] |
| InChI | InChI=1S/C3H8S.Sn.H/c1-3(2)4;;/h3-4H,1-2H3;;/q;+1;/p-1 |
| InChIKey | VPPGHDABMGDUPC-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.88 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-ylsulfanyl-λ2-stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylsulfanyl-λ2-stannane?
The IUPAC name of propan-2-ylsulfanyl-λ2-stannane (CID 174641413) is propan-2-ylsulfanyl-λ2-stannane.
What is the SMILES notation for propan-2-ylsulfanyl-λ2-stannane?
The canonical SMILES for propan-2-ylsulfanyl-λ2-stannane is CC(C)S[SnH].
What is the InChIKey of propan-2-ylsulfanyl-λ2-stannane?
The InChIKey is VPPGHDABMGDUPC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8S.Sn.H/c1-3(2)4;;/h3-4H,1-2H3;;/q;+1;/p-1.
What are the key properties of propan-2-ylsulfanyl-λ2-stannane?
propan-2-ylsulfanyl-λ2-stannane has a molecular weight of 194.88 g/mol, XLogP of 0.94, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylsulfanyl-λ2-stannane is sourced from PubChem (CID 174641413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).