C11H13NO2 — CID 174642930
(3S)-7-hydroxy-2,3-dimethyl-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174642930) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (3S)-7-hydroxy-2,3-dimethyl-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | (3S)-7-hydroxy-2,3-dimethyl-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174642930 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3S)-7-hydroxy-2,3-dimethyl-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | C[C@H]1c2cccc(O)c2C(C=O)N1C |
| InChI | InChI=1S/C11H13NO2/c1-7-8-4-3-5-10(14)11(8)9(6-13)12(7)2/h3-7,9,14H,1-2H3/t7-,9?/m0/s1 |
| InChIKey | PKHDVXQTSCWOIB-JAVCKPHESA-N |
| XLogP | 1.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|