About 3-butyl-1H-phenalene
3-butyl-1H-phenalene (PubChem CID 174644054) has the molecular formula C17H18
and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-butyl-1H-phenalene.
Molecular Properties
| Compound Name | 3-butyl-1H-phenalene |
| PubChem CID | 174644054 |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-butyl-1H-phenalene |
| SMILES | CCCCC1=CCc2cccc3cccc1c23 |
| InChI | InChI=1S/C17H18/c1-2-3-6-13-11-12-15-8-4-7-14-9-5-10-16(13)17(14)15/h4-5,7-11H,2-3,6,12H2,1H3 |
| InChIKey | XJNSDBCYUHLILL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-butyl-1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1H-phenalene?
The IUPAC name of 3-butyl-1H-phenalene (CID 174644054) is 3-butyl-1H-phenalene.
What is the SMILES notation for 3-butyl-1H-phenalene?
The canonical SMILES for 3-butyl-1H-phenalene is CCCCC1=CCc2cccc3cccc1c23.
What is the InChIKey of 3-butyl-1H-phenalene?
The InChIKey is XJNSDBCYUHLILL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18/c1-2-3-6-13-11-12-15-8-4-7-14-9-5-10-16(13)17(14)15/h4-5,7-11H,2-3,6,12H2,1H3.
What are the key properties of 3-butyl-1H-phenalene?
3-butyl-1H-phenalene has a molecular weight of 222.33 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1H-phenalene is sourced from PubChem (CID 174644054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).