About CID 175026640
CID 175026640 (PubChem CID 175026640) has the molecular formula C15H15Si
and a molecular weight of 223.37 g/mol.
Molecular Properties
| Compound Name | CID 175026640 |
| PubChem CID | 175026640 |
| Molecular Formula | C15H15Si |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | — |
| SMILES | C[Si](C)C1=CCc2cccc3cccc1c23 |
| InChI | InChI=1S/C15H15Si/c1-16(2)14-10-9-12-6-3-5-11-7-4-8-13(14)15(11)12/h3-8,10H,9H2,1-2H3 |
| InChIKey | CXWJEDUECHZVRN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175026640 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175026640?
The IUPAC name of CID 175026640 (CID 175026640) is not available.
What is the SMILES notation for CID 175026640?
The canonical SMILES for CID 175026640 is C[Si](C)C1=CCc2cccc3cccc1c23.
What is the InChIKey of CID 175026640?
The InChIKey is CXWJEDUECHZVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Si/c1-16(2)14-10-9-12-6-3-5-11-7-4-8-13(14)15(11)12/h3-8,10H,9H2,1-2H3.
What are the key properties of CID 175026640?
CID 175026640 has a molecular weight of 223.37 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175026640 is sourced from PubChem (CID 175026640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).