About 3H-phenalen-1-ylmethanol
3H-phenalen-1-ylmethanol (PubChem CID 174363850) has the molecular formula C14H12O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3H-phenalen-1-ylmethanol.
Molecular Properties
| Compound Name | 3H-phenalen-1-ylmethanol |
| PubChem CID | 174363850 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 3H-phenalen-1-ylmethanol |
| SMILES | OCC1=CCc2cccc3cccc1c23 |
| InChI | InChI=1S/C14H12O/c15-9-12-8-7-11-4-1-3-10-5-2-6-13(12)14(10)11/h1-6,8,15H,7,9H2 |
| InChIKey | HXBWQNPVOMFPLJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3H-phenalen-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-phenalen-1-ylmethanol?
The IUPAC name of 3H-phenalen-1-ylmethanol (CID 174363850) is 3H-phenalen-1-ylmethanol.
What is the SMILES notation for 3H-phenalen-1-ylmethanol?
The canonical SMILES for 3H-phenalen-1-ylmethanol is OCC1=CCc2cccc3cccc1c23.
What is the InChIKey of 3H-phenalen-1-ylmethanol?
The InChIKey is HXBWQNPVOMFPLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O/c15-9-12-8-7-11-4-1-3-10-5-2-6-13(12)14(10)11/h1-6,8,15H,7,9H2.
What are the key properties of 3H-phenalen-1-ylmethanol?
3H-phenalen-1-ylmethanol has a molecular weight of 196.25 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-phenalen-1-ylmethanol is sourced from PubChem (CID 174363850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).