C21H24F3N3O2 — CID 174648293
benzyl 2-[2-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanoate (PubChem CID 174648293) has the molecular formula C21H24F3N3O2 and a molecular weight of 407.44 g/mol. Its IUPAC name is benzyl 2-[2-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanoate.
| Compound Name | benzyl 2-[2-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 174648293 |
| Molecular Formula | C21H24F3N3O2 |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | benzyl 2-[2-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanoate |
| SMILES | CC1CN(c2ccc(C(F)(F)F)cn2)CCN1C(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24F3N3O2/c1-15-13-26(19-9-8-18(12-25-19)21(22,23)24)10-11-27(15)16(2)20(28)29-14-17-6-4-3-5-7-17/h3-9,12,15-16H,10-11,13-14H2,1-2H3 |
| InChIKey | HVLHWUGHNOUPRU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |