C21H19FN4O2 — CID 174654358
N-(4-fluorophenyl)-4-methylbenzamide;3-pyrimidin-5-ylprop-2-enamide (PubChem CID 174654358) has the molecular formula C21H19FN4O2 and a molecular weight of 378.41 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-methylbenzamide;3-pyrimidin-5-ylprop-2-enamide.
| Compound Name | N-(4-fluorophenyl)-4-methylbenzamide;3-pyrimidin-5-ylprop-2-enamide |
|---|---|
| PubChem CID | 174654358 |
| Molecular Formula | C21H19FN4O2 |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(4-fluorophenyl)-4-methylbenzamide;3-pyrimidin-5-ylprop-2-enamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(F)cc2)cc1.NC(=O)C=Cc1cncnc1 |
| InChI | InChI=1S/C14H12FNO.C7H7N3O/c1-10-2-4-11(5-3-10)14(17)16-13-8-6-12(15)7-9-13;8-7(11)2-1-6-3-9-5-10-4-6/h2-9H,1H3,(H,16,17);1-5H,(H2,8,11) |
| InChIKey | BHLVSSTUDYRXPF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|