C15H14N2O4 — CID 174655741
1,2-dinitro-3-(3-phenylpropyl)benzene (PubChem CID 174655741) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1,2-dinitro-3-(3-phenylpropyl)benzene.
| Compound Name | 1,2-dinitro-3-(3-phenylpropyl)benzene |
|---|---|
| PubChem CID | 174655741 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1,2-dinitro-3-(3-phenylpropyl)benzene |
| SMILES | O=[N+]([O-])c1cccc(CCCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N2O4/c18-16(19)14-11-5-10-13(15(14)17(20)21)9-4-8-12-6-2-1-3-7-12/h1-3,5-7,10-11H,4,8-9H2 |
| InChIKey | ILWZWBHLHGWKQF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|