About 2-(2,3-dinitrophenyl)ethyl formate
2-(2,3-dinitrophenyl)ethyl formate (PubChem CID 91803762) has the molecular formula C9H8N2O6
and a molecular weight of 240.17 g/mol. Its IUPAC name is 2-(2,3-dinitrophenyl)ethyl formate.
Molecular Properties
| Compound Name | 2-(2,3-dinitrophenyl)ethyl formate |
| PubChem CID | 91803762 |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-(2,3-dinitrophenyl)ethyl formate |
| SMILES | O=COCCc1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O6/c12-6-17-5-4-7-2-1-3-8(10(13)14)9(7)11(15)16/h1-3,6H,4-5H2 |
| InChIKey | GRYQNIFVSFBTCM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dinitrophenyl)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dinitrophenyl)ethyl formate?
The IUPAC name of 2-(2,3-dinitrophenyl)ethyl formate (CID 91803762) is 2-(2,3-dinitrophenyl)ethyl formate.
What is the SMILES notation for 2-(2,3-dinitrophenyl)ethyl formate?
The canonical SMILES for 2-(2,3-dinitrophenyl)ethyl formate is O=COCCc1cccc([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 2-(2,3-dinitrophenyl)ethyl formate?
The InChIKey is GRYQNIFVSFBTCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O6/c12-6-17-5-4-7-2-1-3-8(10(13)14)9(7)11(15)16/h1-3,6H,4-5H2.
What are the key properties of 2-(2,3-dinitrophenyl)ethyl formate?
2-(2,3-dinitrophenyl)ethyl formate has a molecular weight of 240.17 g/mol, XLogP of 1.22, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dinitrophenyl)ethyl formate is sourced from PubChem (CID 91803762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).