C25H20N2O4P+ — CID 86092889
(2,3-dinitrophenyl)methyl-triphenylphosphanium (PubChem CID 86092889) has the molecular formula C25H20N2O4P+ and a molecular weight of 443.42 g/mol. Its IUPAC name is (2,3-dinitrophenyl)methyl-triphenylphosphanium.
| Compound Name | (2,3-dinitrophenyl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 86092889 |
| Molecular Formula | C25H20N2O4P+ |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (2,3-dinitrophenyl)methyl-triphenylphosphanium |
| SMILES | O=[N+]([O-])c1cccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20N2O4P/c28-26(29)24-18-10-11-20(25(24)27(30)31)19-32(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-18H,19H2/q+1 |
| InChIKey | JTGJAQVPGNMOCW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|