About chlorosilane;N-ethenyl-N-ethylethanamine
chlorosilane;N-ethenyl-N-ethylethanamine (PubChem CID 174659520) has the molecular formula C6H16ClNSi
and a molecular weight of 165.74 g/mol. Its IUPAC name is chlorosilane;N-ethenyl-N-ethylethanamine.
Molecular Properties
| Compound Name | chlorosilane;N-ethenyl-N-ethylethanamine |
| PubChem CID | 174659520 |
| Molecular Formula | C6H16ClNSi |
| Molecular Weight | 165.74 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | chlorosilane;N-ethenyl-N-ethylethanamine |
| SMILES | C=CN(CC)CC.[SiH3]Cl |
| InChI | InChI=1S/C6H13N.ClH3Si/c1-4-7(5-2)6-3;1-2/h4H,1,5-6H2,2-3H3;2H3 |
| InChIKey | XFRLUHWJWSTNTN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.74 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chlorosilane;N-ethenyl-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorosilane;N-ethenyl-N-ethylethanamine?
The IUPAC name of chlorosilane;N-ethenyl-N-ethylethanamine (CID 174659520) is chlorosilane;N-ethenyl-N-ethylethanamine.
What is the SMILES notation for chlorosilane;N-ethenyl-N-ethylethanamine?
The canonical SMILES for chlorosilane;N-ethenyl-N-ethylethanamine is C=CN(CC)CC.[SiH3]Cl.
What is the InChIKey of chlorosilane;N-ethenyl-N-ethylethanamine?
The InChIKey is XFRLUHWJWSTNTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.ClH3Si/c1-4-7(5-2)6-3;1-2/h4H,1,5-6H2,2-3H3;2H3.
What are the key properties of chlorosilane;N-ethenyl-N-ethylethanamine?
chlorosilane;N-ethenyl-N-ethylethanamine has a molecular weight of 165.74 g/mol, XLogP of 0.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorosilane;N-ethenyl-N-ethylethanamine is sourced from PubChem (CID 174659520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).