C15H27NO — CID 174660935
azane;2,3-ditert-butyl-4-methylphenol (PubChem CID 174660935) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is azane;2,3-ditert-butyl-4-methylphenol.
| Compound Name | azane;2,3-ditert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 174660935 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | azane;2,3-ditert-butyl-4-methylphenol |
| SMILES | Cc1ccc(O)c(C(C)(C)C)c1C(C)(C)C.N |
| InChI | InChI=1S/C15H24O.H3N/c1-10-8-9-11(16)13(15(5,6)7)12(10)14(2,3)4;/h8-9,16H,1-7H3;1H3 |
| InChIKey | XJUJAKKKAZPZAP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |