C29H34O5 — CID 174924594
benzoyl benzenecarboperoxoate;2,3-ditert-butyl-4-methylphenol (PubChem CID 174924594) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is benzoyl benzenecarboperoxoate;2,3-ditert-butyl-4-methylphenol.
| Compound Name | benzoyl benzenecarboperoxoate;2,3-ditert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 174924594 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | benzoyl benzenecarboperoxoate;2,3-ditert-butyl-4-methylphenol |
| SMILES | Cc1ccc(O)c(C(C)(C)C)c1C(C)(C)C.O=C(OOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H24O.C14H10O4/c1-10-8-9-11(16)13(15(5,6)7)12(10)14(2,3)4;15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h8-9,16H,1-7H3;1-10H |
| InChIKey | MPFBWRLPLVJWMI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|