C14H23O4P — CID 150684584
(2,3-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphite (PubChem CID 150684584) has the molecular formula C14H23O4P and a molecular weight of 286.31 g/mol. Its IUPAC name is (2,3-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphite.
| Compound Name | (2,3-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphite |
|---|---|
| PubChem CID | 150684584 |
| Molecular Formula | C14H23O4P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2,3-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphite |
| SMILES | CC(C)(C)c1c(O)ccc(OP(O)O)c1C(C)(C)C |
| InChI | InChI=1S/C14H23O4P/c1-13(2,3)11-9(15)7-8-10(18-19(16)17)12(11)14(4,5)6/h7-8,15-17H,1-6H3 |
| InChIKey | SCVIKOHRLYZHIO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|