About 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole
4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole (PubChem CID 169026312) has the molecular formula C19H24Ge
and a molecular weight of 325.01 g/mol. Its IUPAC name is 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole.
Molecular Properties
| Compound Name | 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole |
| PubChem CID | 169026312 |
| Molecular Formula | C19H24Ge |
| Molecular Weight | 325.01 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole |
| SMILES | Cc1ccc2c(c1C(C)(C)C)[Ge](C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C19H24Ge/c1-13-11-12-15-14-9-7-8-10-16(14)20(5,6)18(15)17(13)19(2,3)4/h7-12H,1-6H3 |
| InChIKey | JFSWTZQUVUYZMB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.01 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole?
The IUPAC name of 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole (CID 169026312) is 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole.
What is the SMILES notation for 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole?
The canonical SMILES for 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole is Cc1ccc2c(c1C(C)(C)C)[Ge](C)(C)c1ccccc1-2.
What is the InChIKey of 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole?
The InChIKey is JFSWTZQUVUYZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Ge/c1-13-11-12-15-14-9-7-8-10-16(14)20(5,6)18(15)17(13)19(2,3)4/h7-12H,1-6H3.
What are the key properties of 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole?
4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole has a molecular weight of 325.01 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,5,5-trimethylbenzo[b][1]benzogermole is sourced from PubChem (CID 169026312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).