C8H5F2IO3 — CID 174661023
3,5-difluoro-2-iodo-4-methoxybenzoic acid (PubChem CID 174661023) has the molecular formula C8H5F2IO3 and a molecular weight of 314.03 g/mol. Its IUPAC name is 3,5-difluoro-2-iodo-4-methoxybenzoic acid.
| Compound Name | 3,5-difluoro-2-iodo-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 174661023 |
| Molecular Formula | C8H5F2IO3 |
| Molecular Weight | 314.03 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 3,5-difluoro-2-iodo-4-methoxybenzoic acid |
| SMILES | COc1c(F)cc(C(=O)O)c(I)c1F |
| InChI | InChI=1S/C8H5F2IO3/c1-14-7-4(9)2-3(8(12)13)6(11)5(7)10/h2H,1H3,(H,12,13) |
| InChIKey | CIAYPOIXFMRECB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.03 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|