C10H14N4OS2 — CID 174664589
N-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]cyclohexanecarboxamide (PubChem CID 174664589) has the molecular formula C10H14N4OS2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 174664589 |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | N-[4,6-bis(sulfanylidene)-1H-1,3,5-triazin-2-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1nc(=S)[nH]c(=S)[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C10H14N4OS2/c15-7(6-4-2-1-3-5-6)11-8-12-9(16)14-10(17)13-8/h6H,1-5H2,(H3,11,12,13,14,15,16,17) |
| InChIKey | FDODFFMFWGSGBU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|