About 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one
1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one (PubChem CID 174665933) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one.
Molecular Properties
| Compound Name | 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one |
| PubChem CID | 174665933 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one |
| SMILES | C=CC1=NC(=O)N=C1C.C=Cn1ccnc1 |
| InChI | InChI=1S/C6H6N2O.C5H6N2/c1-3-5-4(2)7-6(9)8-5;1-2-7-4-3-6-5-7/h3H,1H2,2H3;2-5H,1H2 |
| InChIKey | WYNJJTFLQORVQE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one?
The IUPAC name of 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one (CID 174665933) is 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one.
What is the SMILES notation for 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one?
The canonical SMILES for 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one is C=CC1=NC(=O)N=C1C.C=Cn1ccnc1.
What is the InChIKey of 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one?
The InChIKey is WYNJJTFLQORVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O.C5H6N2/c1-3-5-4(2)7-6(9)8-5;1-2-7-4-3-6-5-7/h3H,1H2,2H3;2-5H,1H2.
What are the key properties of 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one?
1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one has a molecular weight of 216.24 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylimidazole;4-ethenyl-5-methylimidazol-2-one is sourced from PubChem (CID 174665933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).