C24H35N3O2 — CID 174669295
tert-butyl (3S)-3-ethyl-2-imino-5-[4-(1H-indol-3-yl)piperidin-1-yl]pentanoate (PubChem CID 174669295) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is tert-butyl (3S)-3-ethyl-2-imino-5-[4-(1H-indol-3-yl)piperidin-1-yl]pentanoate.
| Compound Name | tert-butyl (3S)-3-ethyl-2-imino-5-[4-(1H-indol-3-yl)piperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 174669295 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | tert-butyl (3S)-3-ethyl-2-imino-5-[4-(1H-indol-3-yl)piperidin-1-yl]pentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)C(CC)CCN1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C24H35N3O2/c1-5-17(22(25)23(28)29-24(2,3)4)10-13-27-14-11-18(12-15-27)20-16-26-21-9-7-6-8-19(20)21/h6-9,16-18,25-26H,5,10-15H2,1-4H3/b25-22- |
| InChIKey | BANYDKRYEWLQOD-LVWGJNHUSA-N |
| XLogP | 5.13 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|