C8H10N4O4 — CID 174670374
(2S)-2-amino-3-[carboxy(pyrimidin-4-yl)amino]propanoic acid (PubChem CID 174670374) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is (2S)-2-amino-3-[carboxy(pyrimidin-4-yl)amino]propanoic acid.
| Compound Name | (2S)-2-amino-3-[carboxy(pyrimidin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 174670374 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (2S)-2-amino-3-[carboxy(pyrimidin-4-yl)amino]propanoic acid |
| SMILES | N[C@@H](CN(C(=O)O)c1ccncn1)C(=O)O |
| InChI | InChI=1S/C8H10N4O4/c9-5(7(13)14)3-12(8(15)16)6-1-2-10-4-11-6/h1-2,4-5H,3,9H2,(H,13,14)(H,15,16)/t5-/m0/s1 |
| InChIKey | QQBPNLCEYDCQSO-YFKPBYRVSA-N |
| XLogP | -0.63 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |