C26H36N2O7 — CID 174673224
dimethyl (Z)-2-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]phenyl]butyl]but-2-enedioate (PubChem CID 174673224) has the molecular formula C26H36N2O7 and a molecular weight of 488.58 g/mol. Its IUPAC name is dimethyl (Z)-2-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]phenyl]butyl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]phenyl]butyl]but-2-enedioate |
|---|---|
| PubChem CID | 174673224 |
| Molecular Formula | C26H36N2O7 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | dimethyl (Z)-2-[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-1-carbonyl]phenyl]butyl]but-2-enedioate |
| SMILES | COC(=O)/C=C(/CCCCc1ccc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)cc1)C(=O)OC |
| InChI | InChI=1S/C26H36N2O7/c1-26(2,3)35-25(32)28-16-14-27(15-17-28)23(30)20-12-10-19(11-13-20)8-6-7-9-21(24(31)34-5)18-22(29)33-4/h10-13,18H,6-9,14-17H2,1-5H3/b21-18- |
| InChIKey | ZYLSUSLMWCKJGC-UZYVYHOESA-N |
| XLogP | 3.36 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|