C9H10F3N3O4 — CID 174674899
[5,5,5-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)pentan-2-yl] formate (PubChem CID 174674899) has the molecular formula C9H10F3N3O4 and a molecular weight of 281.19 g/mol. Its IUPAC name is [5,5,5-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)pentan-2-yl] formate.
| Compound Name | [5,5,5-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)pentan-2-yl] formate |
|---|---|
| PubChem CID | 174674899 |
| Molecular Formula | C9H10F3N3O4 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | [5,5,5-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)pentan-2-yl] formate |
| SMILES | O=COC(CCC(F)(F)F)Cc1[nH]ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10F3N3O4/c10-9(11,12)2-1-6(19-5-16)3-7-8(15(17)18)4-13-14-7/h4-6H,1-3H2,(H,13,14) |
| InChIKey | ODOOFRJXEBRPGO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|