C11H15FN6O3 — CID 118385226
5-[[(2S,5R,6S,7S)-5-azido-6-fluoro-7-methyloxepan-2-yl]methyl]-4-nitro-1H-pyrazole (PubChem CID 118385226) has the molecular formula C11H15FN6O3 and a molecular weight of 298.28 g/mol. Its IUPAC name is 5-[[(2S,5R,6S,7S)-5-azido-6-fluoro-7-methyloxepan-2-yl]methyl]-4-nitro-1H-pyrazole.
| Compound Name | 5-[[(2S,5R,6S,7S)-5-azido-6-fluoro-7-methyloxepan-2-yl]methyl]-4-nitro-1H-pyrazole |
|---|---|
| PubChem CID | 118385226 |
| Molecular Formula | C11H15FN6O3 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[[(2S,5R,6S,7S)-5-azido-6-fluoro-7-methyloxepan-2-yl]methyl]-4-nitro-1H-pyrazole |
| SMILES | C[C@@H]1O[C@H](Cc2[nH]ncc2[N+](=O)[O-])CC[C@@H](N=[N+]=[N-])[C@@H]1F |
| InChI | InChI=1S/C11H15FN6O3/c1-6-11(12)8(16-17-13)3-2-7(21-6)4-9-10(18(19)20)5-14-15-9/h5-8,11H,2-4H2,1H3,(H,14,15)/t6-,7-,8+,11+/m0/s1 |
| InChIKey | LQZUBKVWZQUGNU-LITAXDCLSA-N |
| XLogP | 2.44 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|