C36H30N2O4 — CID 174681588
3,3-dimethyl-2-(3-nitrophenyl)-2,4-dihydro-1H-chrysene;quinoline-6-carboxylic acid (PubChem CID 174681588) has the molecular formula C36H30N2O4 and a molecular weight of 554.65 g/mol. Its IUPAC name is 3,3-dimethyl-2-(3-nitrophenyl)-2,4-dihydro-1H-chrysene;quinoline-6-carboxylic acid.
| Compound Name | 3,3-dimethyl-2-(3-nitrophenyl)-2,4-dihydro-1H-chrysene;quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 174681588 |
| Molecular Formula | C36H30N2O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 3,3-dimethyl-2-(3-nitrophenyl)-2,4-dihydro-1H-chrysene;quinoline-6-carboxylic acid |
| SMILES | CC1(C)Cc2c(ccc3c2ccc2ccccc23)CC1c1cccc([N+](=O)[O-])c1.O=C(O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H23NO2.C10H7NO2/c1-26(2)16-24-18(15-25(26)19-7-5-8-20(14-19)27(28)29)11-13-22-21-9-4-3-6-17(21)10-12-23(22)24;12-10(13)8-3-4-9-7(6-8)2-1-5-11-9/h3-14,25H,15-16H2,1-2H3;1-6H,(H,12,13) |
| InChIKey | PQXQSPBUVFFFSS-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|