About 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane
3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane (PubChem CID 174683999) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane |
| PubChem CID | 174683999 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane |
| SMILES | C1CC2OC2C1.NCc1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C10H13NO2.C5H8O/c11-7-9-3-1-2-8(6-9)4-5-10(12)13;1-2-4-5(3-1)6-4/h1-3,6H,4-5,7,11H2,(H,12,13);4-5H,1-3H2 |
| InChIKey | MXSVZIJUYSDWCA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane?
The IUPAC name of 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane (CID 174683999) is 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane.
What is the SMILES notation for 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane?
The canonical SMILES for 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane is C1CC2OC2C1.NCc1cccc(CCC(=O)O)c1.
What is the InChIKey of 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane?
The InChIKey is MXSVZIJUYSDWCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C5H8O/c11-7-9-3-1-2-8(6-9)4-5-10(12)13;1-2-4-5(3-1)6-4/h1-3,6H,4-5,7,11H2,(H,12,13);4-5H,1-3H2.
What are the key properties of 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane?
3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane has a molecular weight of 263.34 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane is sourced from PubChem (CID 174683999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).