C15H21NO3 — CID 174683999
3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane (PubChem CID 174683999) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane.
| Compound Name | 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 174683999 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-[3-(aminomethyl)phenyl]propanoic acid;6-oxabicyclo[3.1.0]hexane |
| SMILES | C1CC2OC2C1.NCc1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C10H13NO2.C5H8O/c11-7-9-3-1-2-8(6-9)4-5-10(12)13;1-2-4-5(3-1)6-4/h1-3,6H,4-5,7,11H2,(H,12,13);4-5H,1-3H2 |
| InChIKey | MXSVZIJUYSDWCA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|