C11H16N2O2 — CID 66516947
3-[3-[(1R)-1,2-diaminoethyl]phenyl]propanoic acid (PubChem CID 66516947) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-[3-[(1R)-1,2-diaminoethyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[(1R)-1,2-diaminoethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66516947 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3-[3-[(1R)-1,2-diaminoethyl]phenyl]propanoic acid |
| SMILES | NC[C@H](N)c1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C11H16N2O2/c12-7-10(13)9-3-1-2-8(6-9)4-5-11(14)15/h1-3,6,10H,4-5,7,12-13H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | ZGXBTAIROFNAFO-JTQLQIEISA-N |
| XLogP | 0.66 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |