C17H14ClN3O4S2 — CID 174685813
(2-chlorophenyl)methyl 4-methyl-2-(pyridine-2-carbonylamino)-1,3-thiazole-5-sulfonate (PubChem CID 174685813) has the molecular formula C17H14ClN3O4S2 and a molecular weight of 423.90 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-methyl-2-(pyridine-2-carbonylamino)-1,3-thiazole-5-sulfonate.
| Compound Name | (2-chlorophenyl)methyl 4-methyl-2-(pyridine-2-carbonylamino)-1,3-thiazole-5-sulfonate |
|---|---|
| PubChem CID | 174685813 |
| Molecular Formula | C17H14ClN3O4S2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | (2-chlorophenyl)methyl 4-methyl-2-(pyridine-2-carbonylamino)-1,3-thiazole-5-sulfonate |
| SMILES | Cc1nc(NC(=O)c2ccccn2)sc1S(=O)(=O)OCc1ccccc1Cl |
| InChI | InChI=1S/C17H14ClN3O4S2/c1-11-16(27(23,24)25-10-12-6-2-3-7-13(12)18)26-17(20-11)21-15(22)14-8-4-5-9-19-14/h2-9H,10H2,1H3,(H,20,21,22) |
| InChIKey | PWHDPMWXVJDKLA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|