C25H34N4O6 — CID 174688273
[4-[5-(N-ethyl-3,5-dimethoxyanilino)-2-nitrophenyl]piperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174688273) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is [4-[5-(N-ethyl-3,5-dimethoxyanilino)-2-nitrophenyl]piperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[5-(N-ethyl-3,5-dimethoxyanilino)-2-nitrophenyl]piperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174688273 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | [4-[5-(N-ethyl-3,5-dimethoxyanilino)-2-nitrophenyl]piperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CCN(c1cc(OC)cc(OC)c1)c1ccc([N+](=O)[O-])c(N2CCN(OC(=O)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C25H34N4O6/c1-7-28(19-14-20(33-5)17-21(15-19)34-6)18-8-9-22(29(31)32)23(16-18)26-10-12-27(13-11-26)35-24(30)25(2,3)4/h8-9,14-17H,7,10-13H2,1-6H3 |
| InChIKey | VBDVBFCEMANUKZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|