C25H20Cl2N3O3S- — CID 174688622
[2-[2-(2,6-dichlorophenyl)-4-(ethylcarbamoyl)imidazol-1-yl]-5-phenylphenyl]methanesulfinate (PubChem CID 174688622) has the molecular formula C25H20Cl2N3O3S- and a molecular weight of 513.43 g/mol. Its IUPAC name is [2-[2-(2,6-dichlorophenyl)-4-(ethylcarbamoyl)imidazol-1-yl]-5-phenylphenyl]methanesulfinate.
| Compound Name | [2-[2-(2,6-dichlorophenyl)-4-(ethylcarbamoyl)imidazol-1-yl]-5-phenylphenyl]methanesulfinate |
|---|---|
| PubChem CID | 174688622 |
| Molecular Formula | C25H20Cl2N3O3S- |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | [2-[2-(2,6-dichlorophenyl)-4-(ethylcarbamoyl)imidazol-1-yl]-5-phenylphenyl]methanesulfinate |
| SMILES | CCNC(=O)c1cn(-c2ccc(-c3ccccc3)cc2CS(=O)[O-])c(-c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C25H21Cl2N3O3S/c1-2-28-25(31)21-14-30(24(29-21)23-19(26)9-6-10-20(23)27)22-12-11-17(13-18(22)15-34(32)33)16-7-4-3-5-8-16/h3-14H,2,15H2,1H3,(H,28,31)(H,32,33)/p-1 |
| InChIKey | KEWCOOGYUZNARZ-UHFFFAOYSA-M |
| XLogP | 5.64 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|