About (2-diazoacetyl) 3-oxobutanoate
(2-diazoacetyl) 3-oxobutanoate (PubChem CID 174688795) has the molecular formula C6H6N2O4
and a molecular weight of 170.12 g/mol. Its IUPAC name is (2-diazoacetyl) 3-oxobutanoate.
Molecular Properties
| Compound Name | (2-diazoacetyl) 3-oxobutanoate |
| PubChem CID | 174688795 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | (2-diazoacetyl) 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C6H6N2O4/c1-4(9)2-5(10)12-6(11)3-8-7/h3H,2H2,1H3 |
| InChIKey | JKWUFQNBMBJSMH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2-diazoacetyl) 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-diazoacetyl) 3-oxobutanoate?
The IUPAC name of (2-diazoacetyl) 3-oxobutanoate (CID 174688795) is (2-diazoacetyl) 3-oxobutanoate.
What is the SMILES notation for (2-diazoacetyl) 3-oxobutanoate?
The canonical SMILES for (2-diazoacetyl) 3-oxobutanoate is CC(=O)CC(=O)OC(=O)C=[N+]=[N-].
What is the InChIKey of (2-diazoacetyl) 3-oxobutanoate?
The InChIKey is JKWUFQNBMBJSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O4/c1-4(9)2-5(10)12-6(11)3-8-7/h3H,2H2,1H3.
What are the key properties of (2-diazoacetyl) 3-oxobutanoate?
(2-diazoacetyl) 3-oxobutanoate has a molecular weight of 170.12 g/mol, XLogP of -0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-diazoacetyl) 3-oxobutanoate is sourced from PubChem (CID 174688795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).