C13H21NO6 — CID 174693091
(2S)-2-[3-carboxybut-2-en-2-yl(carboxymethyl)amino]-4-methylpentanoic acid (PubChem CID 174693091) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is (2S)-2-[3-carboxybut-2-en-2-yl(carboxymethyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[3-carboxybut-2-en-2-yl(carboxymethyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 174693091 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (2S)-2-[3-carboxybut-2-en-2-yl(carboxymethyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C(=O)O)=C(C)N(CC(=O)O)[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H21NO6/c1-7(2)5-10(13(19)20)14(6-11(15)16)9(4)8(3)12(17)18/h7,10H,5-6H2,1-4H3,(H,15,16)(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | LLZANKVMNVGYFQ-JTQLQIEISA-N |
| XLogP | 1.25 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|