C16H21NO3S — CID 174698988
4-[(2R)-5-(4-methylsulfonylphenyl)-2,3-dihydrofuran-2-yl]piperidine (PubChem CID 174698988) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is 4-[(2R)-5-(4-methylsulfonylphenyl)-2,3-dihydrofuran-2-yl]piperidine.
| Compound Name | 4-[(2R)-5-(4-methylsulfonylphenyl)-2,3-dihydrofuran-2-yl]piperidine |
|---|---|
| PubChem CID | 174698988 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[(2R)-5-(4-methylsulfonylphenyl)-2,3-dihydrofuran-2-yl]piperidine |
| SMILES | CS(=O)(=O)c1ccc(C2=CC[C@H](C3CCNCC3)O2)cc1 |
| InChI | InChI=1S/C16H21NO3S/c1-21(18,19)14-4-2-12(3-5-14)15-6-7-16(20-15)13-8-10-17-11-9-13/h2-6,13,16-17H,7-11H2,1H3/t16-/m1/s1 |
| InChIKey | WIZUEMBUBKEDEL-MRXNPFEDSA-N |
| XLogP | 2.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |