About oxomethylideneiron;triphenylphosphane
oxomethylideneiron;triphenylphosphane (PubChem CID 174701658) has the molecular formula C19H15FeOP
and a molecular weight of 346.15 g/mol. Its IUPAC name is oxomethylideneiron;triphenylphosphane.
Molecular Properties
| Compound Name | oxomethylideneiron;triphenylphosphane |
| PubChem CID | 174701658 |
| Molecular Formula | C19H15FeOP |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | oxomethylideneiron;triphenylphosphane |
| SMILES | O=C=[Fe].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.CO.Fe/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2;/h1-15H;; |
| InChIKey | USKDARVJKFOJAY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxomethylideneiron;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxomethylideneiron;triphenylphosphane?
The IUPAC name of oxomethylideneiron;triphenylphosphane (CID 174701658) is oxomethylideneiron;triphenylphosphane.
What is the SMILES notation for oxomethylideneiron;triphenylphosphane?
The canonical SMILES for oxomethylideneiron;triphenylphosphane is O=C=[Fe].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of oxomethylideneiron;triphenylphosphane?
The InChIKey is USKDARVJKFOJAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.CO.Fe/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2;/h1-15H;;.
What are the key properties of oxomethylideneiron;triphenylphosphane?
oxomethylideneiron;triphenylphosphane has a molecular weight of 346.15 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxomethylideneiron;triphenylphosphane is sourced from PubChem (CID 174701658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).