About sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate
sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate (PubChem CID 174703416) has the molecular formula C12H9ClNNaO4S
and a molecular weight of 321.72 g/mol. Its IUPAC name is sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate.
Molecular Properties
| Compound Name | sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate |
| PubChem CID | 174703416 |
| Molecular Formula | C12H9ClNNaO4S |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate |
| SMILES | O=[N+]([O-])c1cc(S(=O)Oc2ccccc2)ccc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C12H8ClNO4S.Na.H/c13-11-7-6-10(8-12(11)14(15)16)19(17)18-9-4-2-1-3-5-9;;/h1-8H;;/q;+1;-1 |
| InChIKey | XMEJJVHNUMSPRT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate?
The IUPAC name of sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate (CID 174703416) is sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate.
What is the SMILES notation for sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate?
The canonical SMILES for sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate is O=[N+]([O-])c1cc(S(=O)Oc2ccccc2)ccc1Cl.[H-].[Na+].
What is the InChIKey of sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate?
The InChIKey is XMEJJVHNUMSPRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClNO4S.Na.H/c13-11-7-6-10(8-12(11)14(15)16)19(17)18-9-4-2-1-3-5-9;;/h1-8H;;/q;+1;-1.
What are the key properties of sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate?
sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate has a molecular weight of 321.72 g/mol, XLogP of 0.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenyl 4-chloro-3-nitrobenzenesulfinate is sourced from PubChem (CID 174703416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).