C35H28Br2Cl4N4O — CID 174703520
1,5-bis(3-bromophenyl)-2,4-bis[5-(2,5-dichlorophenyl)-3,4-dihydropyrazol-2-yl]pentan-3-one (PubChem CID 174703520) has the molecular formula C35H28Br2Cl4N4O and a molecular weight of 822.26 g/mol. Its IUPAC name is 1,5-bis(3-bromophenyl)-2,4-bis[5-(2,5-dichlorophenyl)-3,4-dihydropyrazol-2-yl]pentan-3-one.
| Compound Name | 1,5-bis(3-bromophenyl)-2,4-bis[5-(2,5-dichlorophenyl)-3,4-dihydropyrazol-2-yl]pentan-3-one |
|---|---|
| PubChem CID | 174703520 |
| Molecular Formula | C35H28Br2Cl4N4O |
| Molecular Weight | 822.26 g/mol |
| Exact Mass | 817.94 |
| IUPAC Name | 1,5-bis(3-bromophenyl)-2,4-bis[5-(2,5-dichlorophenyl)-3,4-dihydropyrazol-2-yl]pentan-3-one |
| SMILES | O=C(C(Cc1cccc(Br)c1)N1CCC(c2cc(Cl)ccc2Cl)=N1)C(Cc1cccc(Br)c1)N1CCC(c2cc(Cl)ccc2Cl)=N1 |
| InChI | InChI=1S/C35H28Br2Cl4N4O/c36-23-5-1-3-21(15-23)17-33(44-13-11-31(42-44)27-19-25(38)7-9-29(27)40)35(46)34(18-22-4-2-6-24(37)16-22)45-14-12-32(43-45)28-20-26(39)8-10-30(28)41/h1-10,15-16,19-20,33-34H,11-14,17-18H2 |
| InChIKey | SHQYURNDHBNQNV-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.26 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |