C9H8N2S — CID 174703681
7-cyclopropylthieno[3,2-d]pyrimidine (PubChem CID 174703681) has the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. Its IUPAC name is 7-cyclopropylthieno[3,2-d]pyrimidine.
| Compound Name | 7-cyclopropylthieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 174703681 |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 7-cyclopropylthieno[3,2-d]pyrimidine |
| SMILES | c1ncc2scc(C3CC3)c2n1 |
| InChI | InChI=1S/C9H8N2S/c1-2-6(1)7-4-12-8-3-10-5-11-9(7)8/h3-6H,1-2H2 |
| InChIKey | IBEDLXDVECNGKB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |