C20H25NO8 — CID 174704188
cyclohexyl (2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylate (PubChem CID 174704188) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is cyclohexyl (2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylate.
| Compound Name | cyclohexyl (2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 174704188 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | cyclohexyl (2S,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-3-(3-hydroxyindol-3-yl)oxane-2-carboxylate |
| SMILES | O=C(OC1CCCCC1)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@]1(O)C1(O)C=Nc2ccccc21 |
| InChI | InChI=1S/C20H25NO8/c22-14-15(23)20(27,19(26)10-21-13-9-5-4-8-12(13)19)16(29-17(14)24)18(25)28-11-6-2-1-3-7-11/h4-5,8-11,14-17,22-24,26-27H,1-3,6-7H2/t14-,15-,16-,17-,19?,20+/m1/s1 |
| InChIKey | FNFKCKGSZYTJKR-KOGABQRESA-N |
| XLogP | -0.36 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |